C18H21N3OS — CID 121139199
(E)-N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 121139199) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is (E)-N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 121139199 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (E)-N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NCCn1nc(C2CC2)cc1C1CC1 |
| InChI | InChI=1S/C18H21N3OS/c22-18(8-7-15-2-1-11-23-15)19-9-10-21-17(14-5-6-14)12-16(20-21)13-3-4-13/h1-2,7-8,11-14H,3-6,9-10H2,(H,19,22)/b8-7+ |
| InChIKey | HAGBVPRVSACAOY-BQYQJAHWSA-N |
| XLogP | 3.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|