C25H28N4O — CID 72718802
1-benzhydryl-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea (PubChem CID 72718802) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea.
| Compound Name | 1-benzhydryl-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 72718802 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-benzhydryl-3-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]urea |
| SMILES | O=C(NCCn1nc(C2CC2)cc1C1CC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O/c30-25(27-24(20-7-3-1-4-8-20)21-9-5-2-6-10-21)26-15-16-29-23(19-13-14-19)17-22(28-29)18-11-12-18/h1-10,17-19,24H,11-16H2,(H2,26,27,30) |
| InChIKey | UXZVYPGKDRNSBV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |