C16H14N4O2S — CID 117055273
(Z)-N-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 117055273) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is (Z)-N-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 117055273 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (Z)-N-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C\c1cccs1)NCCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C16H14N4O2S/c21-15(8-7-12-4-3-11-23-12)17-9-10-20-16(22)13-5-1-2-6-14(13)18-19-20/h1-8,11H,9-10H2,(H,17,21)/b8-7- |
| InChIKey | CLMNQYIVIQKVLK-FPLPWBNLSA-N |
| XLogP | 1.68 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|