C28H27N5O4 — CID 154054461
N-[3-[5-cyclobutyl-1-[(4-methoxyphenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]pyridine-4-carboxamide (PubChem CID 154054461) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is N-[3-[5-cyclobutyl-1-[(4-methoxyphenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[5-cyclobutyl-1-[(4-methoxyphenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 154054461 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[3-[5-cyclobutyl-1-[(4-methoxyphenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)n2nc(-c3cc(NC(=O)c4ccncc4)ccc3O)cc2C2CCC2)cc1 |
| InChI | InChI=1S/C28H27N5O4/c1-37-22-8-5-18(6-9-22)17-30-28(36)33-25(19-3-2-4-19)16-24(32-33)23-15-21(7-10-26(23)34)31-27(35)20-11-13-29-14-12-20/h5-16,19,34H,2-4,17H2,1H3,(H,30,36)(H,31,35) |
| InChIKey | HEIWWTQUPPJQOT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|