C30H29ClN4O4 — CID 154054992
N-[(2-chlorophenyl)methyl]-5-cyclobutyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide (PubChem CID 154054992) has the molecular formula C30H29ClN4O4 and a molecular weight of 545.04 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-cyclobutyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-cyclobutyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054992 |
| Molecular Formula | C30H29ClN4O4 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-cyclobutyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(O)c(-c3cc(C4CCC4)n(C(=O)NCc4ccccc4Cl)n3)c2)cc1 |
| InChI | InChI=1S/C30H29ClN4O4/c1-2-39-23-13-10-20(11-14-23)29(37)33-22-12-15-28(36)24(16-22)26-17-27(19-7-5-8-19)35(34-26)30(38)32-18-21-6-3-4-9-25(21)31/h3-4,6,9-17,19,36H,2,5,7-8,18H2,1H3,(H,32,38)(H,33,37) |
| InChIKey | PBZGPQVZBUWOCT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|