C27H23Cl2N5O3 — CID 154055358
2-chloro-N-[4-[1-[(2-chlorophenyl)methylcarbamoyl]-5-cyclobutylpyrazol-3-yl]-3-hydroxyphenyl]pyridine-3-carboxamide (PubChem CID 154055358) has the molecular formula C27H23Cl2N5O3 and a molecular weight of 536.42 g/mol. Its IUPAC name is 2-chloro-N-[4-[1-[(2-chlorophenyl)methylcarbamoyl]-5-cyclobutylpyrazol-3-yl]-3-hydroxyphenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-[1-[(2-chlorophenyl)methylcarbamoyl]-5-cyclobutylpyrazol-3-yl]-3-hydroxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154055358 |
| Molecular Formula | C27H23Cl2N5O3 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 2-chloro-N-[4-[1-[(2-chlorophenyl)methylcarbamoyl]-5-cyclobutylpyrazol-3-yl]-3-hydroxyphenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cc(C3CCC3)n(C(=O)NCc3ccccc3Cl)n2)c(O)c1)c1cccnc1Cl |
| InChI | InChI=1S/C27H23Cl2N5O3/c28-21-9-2-1-5-17(21)15-31-27(37)34-23(16-6-3-7-16)14-22(33-34)19-11-10-18(13-24(19)35)32-26(36)20-8-4-12-30-25(20)29/h1-2,4-5,8-14,16,35H,3,6-7,15H2,(H,31,37)(H,32,36) |
| InChIKey | MTLPCQIYMNNHAS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|