C28H24Cl2N4O3 — CID 154054997
3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-N-[(2-chlorophenyl)methyl]-5-cyclobutylpyrazole-1-carboxamide (PubChem CID 154054997) has the molecular formula C28H24Cl2N4O3 and a molecular weight of 535.43 g/mol. Its IUPAC name is 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-N-[(2-chlorophenyl)methyl]-5-cyclobutylpyrazole-1-carboxamide.
| Compound Name | 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-N-[(2-chlorophenyl)methyl]-5-cyclobutylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054997 |
| Molecular Formula | C28H24Cl2N4O3 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-N-[(2-chlorophenyl)methyl]-5-cyclobutylpyrazole-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2cc(C3CCC3)n(C(=O)NCc3ccccc3Cl)n2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24Cl2N4O3/c29-20-10-8-18(9-11-20)27(36)32-21-12-13-26(35)22(14-21)24-15-25(17-5-3-6-17)34(33-24)28(37)31-16-19-4-1-2-7-23(19)30/h1-2,4,7-15,17,35H,3,5-6,16H2,(H,31,37)(H,32,36) |
| InChIKey | YFUOQUMOGRTJMK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|