C31H32N4O3 — CID 154054851
N-benzyl-5-cyclopentyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide (PubChem CID 154054851) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is N-benzyl-5-cyclopentyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide.
| Compound Name | N-benzyl-5-cyclopentyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054851 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | N-benzyl-5-cyclopentyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(O)c(-c3cc(C4CCCC4)n(C(=O)NCc4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C31H32N4O3/c1-2-21-12-14-24(15-13-21)30(37)33-25-16-17-29(36)26(18-25)27-19-28(23-10-6-7-11-23)35(34-27)31(38)32-20-22-8-4-3-5-9-22/h3-5,8-9,12-19,23,36H,2,6-7,10-11,20H2,1H3,(H,32,38)(H,33,37) |
| InChIKey | PMZXLNAKARJAPQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|