C30H29ClN4O3 — CID 154055018
3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopentyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide (PubChem CID 154055018) has the molecular formula C30H29ClN4O3 and a molecular weight of 529.04 g/mol. Its IUPAC name is 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopentyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide.
| Compound Name | 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopentyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055018 |
| Molecular Formula | C30H29ClN4O3 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopentyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide |
| SMILES | Cc1cccc(CNC(=O)n2nc(-c3cc(NC(=O)c4ccc(Cl)cc4)ccc3O)cc2C2CCCC2)c1 |
| InChI | InChI=1S/C30H29ClN4O3/c1-19-5-4-6-20(15-19)18-32-30(38)35-27(21-7-2-3-8-21)17-26(34-35)25-16-24(13-14-28(25)36)33-29(37)22-9-11-23(31)12-10-22/h4-6,9-17,21,36H,2-3,7-8,18H2,1H3,(H,32,38)(H,33,37) |
| InChIKey | YXUHPDBJDZKLSZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|