C28H25ClN4O3 — CID 154055045
3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide (PubChem CID 154055045) has the molecular formula C28H25ClN4O3 and a molecular weight of 500.99 g/mol. Its IUPAC name is 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide.
| Compound Name | 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055045 |
| Molecular Formula | C28H25ClN4O3 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 3-[5-[(4-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-[(3-methylphenyl)methyl]pyrazole-1-carboxamide |
| SMILES | Cc1cccc(CNC(=O)n2nc(-c3cc(NC(=O)c4ccc(Cl)cc4)ccc3O)cc2C2CC2)c1 |
| InChI | InChI=1S/C28H25ClN4O3/c1-17-3-2-4-18(13-17)16-30-28(36)33-25(19-5-6-19)15-24(32-33)23-14-22(11-12-26(23)34)31-27(35)20-7-9-21(29)10-8-20/h2-4,7-15,19,34H,5-6,16H2,1H3,(H,30,36)(H,31,35) |
| InChIKey | OSWNKSSKXZGUKW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|