C32H32Cl2N4O3 — CID 154054937
3-[5-[(4-tert-butylbenzoyl)amino]-2-hydroxyphenyl]-5-cyclobutyl-N-[(3,4-dichlorophenyl)methyl]pyrazole-1-carboxamide (PubChem CID 154054937) has the molecular formula C32H32Cl2N4O3 and a molecular weight of 591.54 g/mol. Its IUPAC name is 3-[5-[(4-tert-butylbenzoyl)amino]-2-hydroxyphenyl]-5-cyclobutyl-N-[(3,4-dichlorophenyl)methyl]pyrazole-1-carboxamide.
| Compound Name | 3-[5-[(4-tert-butylbenzoyl)amino]-2-hydroxyphenyl]-5-cyclobutyl-N-[(3,4-dichlorophenyl)methyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054937 |
| Molecular Formula | C32H32Cl2N4O3 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 3-[5-[(4-tert-butylbenzoyl)amino]-2-hydroxyphenyl]-5-cyclobutyl-N-[(3,4-dichlorophenyl)methyl]pyrazole-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(O)c(-c3cc(C4CCC4)n(C(=O)NCc4ccc(Cl)c(Cl)c4)n3)c2)cc1 |
| InChI | InChI=1S/C32H32Cl2N4O3/c1-32(2,3)22-10-8-21(9-11-22)30(40)36-23-12-14-29(39)24(16-23)27-17-28(20-5-4-6-20)38(37-27)31(41)35-18-19-7-13-25(33)26(34)15-19/h7-17,20,39H,4-6,18H2,1-3H3,(H,35,41)(H,36,40) |
| InChIKey | IIFPIDBUAIMKSG-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|