C26H23Cl2N5O4 — CID 154054277
N-[3-[5-cyclopentyl-1-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide (PubChem CID 154054277) has the molecular formula C26H23Cl2N5O4 and a molecular weight of 540.41 g/mol. Its IUPAC name is N-[3-[5-cyclopentyl-1-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-[5-cyclopentyl-1-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 154054277 |
| Molecular Formula | C26H23Cl2N5O4 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | N-[3-[5-cyclopentyl-1-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2cc(C3CCCC3)n(C(=O)NCc3ccc(Cl)c(Cl)c3)n2)c1)c1ccno1 |
| InChI | InChI=1S/C26H23Cl2N5O4/c27-19-7-5-15(11-20(19)28)14-29-26(36)33-22(16-3-1-2-4-16)13-21(32-33)18-12-17(6-8-23(18)34)31-25(35)24-9-10-30-37-24/h5-13,16,34H,1-4,14H2,(H,29,36)(H,31,35) |
| InChIKey | NOTGCWMWIXPILH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|