C26H24FN5O4 — CID 154054273
N-[3-[5-cyclopentyl-1-[(2-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide (PubChem CID 154054273) has the molecular formula C26H24FN5O4 and a molecular weight of 489.51 g/mol. Its IUPAC name is N-[3-[5-cyclopentyl-1-[(2-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-[5-cyclopentyl-1-[(2-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 154054273 |
| Molecular Formula | C26H24FN5O4 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[3-[5-cyclopentyl-1-[(2-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2cc(C3CCCC3)n(C(=O)NCc3ccccc3F)n2)c1)c1ccno1 |
| InChI | InChI=1S/C26H24FN5O4/c27-20-8-4-3-7-17(20)15-28-26(35)32-22(16-5-1-2-6-16)14-21(31-32)19-13-18(9-10-23(19)33)30-25(34)24-11-12-29-36-24/h3-4,7-14,16,33H,1-2,5-6,15H2,(H,28,35)(H,30,34) |
| InChIKey | XDTSLBKKLBJNLD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|