C26H28N4O3 — CID 154054854
5-cyclobutyl-N-cyclopropyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide (PubChem CID 154054854) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 5-cyclobutyl-N-cyclopropyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide.
| Compound Name | 5-cyclobutyl-N-cyclopropyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054854 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 5-cyclobutyl-N-cyclopropyl-3-[5-[(4-ethylbenzoyl)amino]-2-hydroxyphenyl]pyrazole-1-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(O)c(-c3cc(C4CCC4)n(C(=O)NC4CC4)n3)c2)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-2-16-6-8-18(9-7-16)25(32)27-20-12-13-24(31)21(14-20)22-15-23(17-4-3-5-17)30(29-22)26(33)28-19-10-11-19/h6-9,12-15,17,19,31H,2-5,10-11H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | BZNBWGVEDZALPS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|