C25H28N4O4 — CID 154055006
5-cyclopropyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide (PubChem CID 154055006) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 5-cyclopropyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide.
| Compound Name | 5-cyclopropyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055006 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 5-cyclopropyl-3-[5-[(4-ethoxybenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(O)c(-c3cc(C4CC4)n(C(=O)NC(C)C)n3)c2)cc1 |
| InChI | InChI=1S/C25H28N4O4/c1-4-33-19-10-7-17(8-11-19)24(31)27-18-9-12-23(30)20(13-18)21-14-22(16-5-6-16)29(28-21)25(32)26-15(2)3/h7-16,30H,4-6H2,1-3H3,(H,26,32)(H,27,31) |
| InChIKey | YALKXHDJVFAJJQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|