C25H25F3N4O4 — CID 154054336
N-butan-2-yl-5-cyclopropyl-3-[2-hydroxy-5-[[4-(trifluoromethoxy)benzoyl]amino]phenyl]pyrazole-1-carboxamide (PubChem CID 154054336) has the molecular formula C25H25F3N4O4 and a molecular weight of 502.49 g/mol. Its IUPAC name is N-butan-2-yl-5-cyclopropyl-3-[2-hydroxy-5-[[4-(trifluoromethoxy)benzoyl]amino]phenyl]pyrazole-1-carboxamide.
| Compound Name | N-butan-2-yl-5-cyclopropyl-3-[2-hydroxy-5-[[4-(trifluoromethoxy)benzoyl]amino]phenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054336 |
| Molecular Formula | C25H25F3N4O4 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-butan-2-yl-5-cyclopropyl-3-[2-hydroxy-5-[[4-(trifluoromethoxy)benzoyl]amino]phenyl]pyrazole-1-carboxamide |
| SMILES | CCC(C)NC(=O)n1nc(-c2cc(NC(=O)c3ccc(OC(F)(F)F)cc3)ccc2O)cc1C1CC1 |
| InChI | InChI=1S/C25H25F3N4O4/c1-3-14(2)29-24(35)32-21(15-4-5-15)13-20(31-32)19-12-17(8-11-22(19)33)30-23(34)16-6-9-18(10-7-16)36-25(26,27)28/h6-15,33H,3-5H2,1-2H3,(H,29,35)(H,30,34) |
| InChIKey | BZNUOMAHMOXJHT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|