C24H34N4O3 — CID 154054734
N-butan-2-yl-5-cyclopentyl-3-[2-hydroxy-5-(3-methylbutanoylamino)phenyl]pyrazole-1-carboxamide (PubChem CID 154054734) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-butan-2-yl-5-cyclopentyl-3-[2-hydroxy-5-(3-methylbutanoylamino)phenyl]pyrazole-1-carboxamide.
| Compound Name | N-butan-2-yl-5-cyclopentyl-3-[2-hydroxy-5-(3-methylbutanoylamino)phenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054734 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N-butan-2-yl-5-cyclopentyl-3-[2-hydroxy-5-(3-methylbutanoylamino)phenyl]pyrazole-1-carboxamide |
| SMILES | CCC(C)NC(=O)n1nc(-c2cc(NC(=O)CC(C)C)ccc2O)cc1C1CCCC1 |
| InChI | InChI=1S/C24H34N4O3/c1-5-16(4)25-24(31)28-21(17-8-6-7-9-17)14-20(27-28)19-13-18(10-11-22(19)29)26-23(30)12-15(2)3/h10-11,13-17,29H,5-9,12H2,1-4H3,(H,25,31)(H,26,30) |
| InChIKey | DXFDOXMJSNYZRP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|