C25H26Cl2N4O3 — CID 154055159
5-cyclopentyl-3-[5-[(2,6-dichlorobenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide (PubChem CID 154055159) has the molecular formula C25H26Cl2N4O3 and a molecular weight of 501.41 g/mol. Its IUPAC name is 5-cyclopentyl-3-[5-[(2,6-dichlorobenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide.
| Compound Name | 5-cyclopentyl-3-[5-[(2,6-dichlorobenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055159 |
| Molecular Formula | C25H26Cl2N4O3 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 5-cyclopentyl-3-[5-[(2,6-dichlorobenzoyl)amino]-2-hydroxyphenyl]-N-propan-2-ylpyrazole-1-carboxamide |
| SMILES | CC(C)NC(=O)n1nc(-c2cc(NC(=O)c3c(Cl)cccc3Cl)ccc2O)cc1C1CCCC1 |
| InChI | InChI=1S/C25H26Cl2N4O3/c1-14(2)28-25(34)31-21(15-6-3-4-7-15)13-20(30-31)17-12-16(10-11-22(17)32)29-24(33)23-18(26)8-5-9-19(23)27/h5,8-15,32H,3-4,6-7H2,1-2H3,(H,28,34)(H,29,33) |
| InChIKey | NBTJRIOWRLXXIS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|