C21H28N4O3 — CID 154055712
5-cyclopentyl-3-[2-hydroxy-4-(propanoylamino)phenyl]-N-propan-2-ylpyrazole-1-carboxamide (PubChem CID 154055712) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-cyclopentyl-3-[2-hydroxy-4-(propanoylamino)phenyl]-N-propan-2-ylpyrazole-1-carboxamide.
| Compound Name | 5-cyclopentyl-3-[2-hydroxy-4-(propanoylamino)phenyl]-N-propan-2-ylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055712 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 5-cyclopentyl-3-[2-hydroxy-4-(propanoylamino)phenyl]-N-propan-2-ylpyrazole-1-carboxamide |
| SMILES | CCC(=O)Nc1ccc(-c2cc(C3CCCC3)n(C(=O)NC(C)C)n2)c(O)c1 |
| InChI | InChI=1S/C21H28N4O3/c1-4-20(27)23-15-9-10-16(19(26)11-15)17-12-18(14-7-5-6-8-14)25(24-17)21(28)22-13(2)3/h9-14,26H,4-8H2,1-3H3,(H,22,28)(H,23,27) |
| InChIKey | AYNLAGAQEVXSPY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |