C23H23ClN4O3 — CID 154055223
3-[5-[(2-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-propan-2-ylpyrazole-1-carboxamide (PubChem CID 154055223) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-[5-[(2-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-propan-2-ylpyrazole-1-carboxamide.
| Compound Name | 3-[5-[(2-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-propan-2-ylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055223 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-[5-[(2-chlorobenzoyl)amino]-2-hydroxyphenyl]-5-cyclopropyl-N-propan-2-ylpyrazole-1-carboxamide |
| SMILES | CC(C)NC(=O)n1nc(-c2cc(NC(=O)c3ccccc3Cl)ccc2O)cc1C1CC1 |
| InChI | InChI=1S/C23H23ClN4O3/c1-13(2)25-23(31)28-20(14-7-8-14)12-19(27-28)17-11-15(9-10-21(17)29)26-22(30)16-5-3-4-6-18(16)24/h3-6,9-14,29H,7-8H2,1-2H3,(H,25,31)(H,26,30) |
| InChIKey | RUQWVOXPNRFCHB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|