C29H36N4O3 — CID 154054399
5-cyclopentyl-3-[5-(2-ethylbutanoylamino)-2-hydroxyphenyl]-N-[(2-methylphenyl)methyl]pyrazole-1-carboxamide (PubChem CID 154054399) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 5-cyclopentyl-3-[5-(2-ethylbutanoylamino)-2-hydroxyphenyl]-N-[(2-methylphenyl)methyl]pyrazole-1-carboxamide.
| Compound Name | 5-cyclopentyl-3-[5-(2-ethylbutanoylamino)-2-hydroxyphenyl]-N-[(2-methylphenyl)methyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054399 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 5-cyclopentyl-3-[5-(2-ethylbutanoylamino)-2-hydroxyphenyl]-N-[(2-methylphenyl)methyl]pyrazole-1-carboxamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(O)c(-c2cc(C3CCCC3)n(C(=O)NCc3ccccc3C)n2)c1 |
| InChI | InChI=1S/C29H36N4O3/c1-4-20(5-2)28(35)31-23-14-15-27(34)24(16-23)25-17-26(21-11-8-9-12-21)33(32-25)29(36)30-18-22-13-7-6-10-19(22)3/h6-7,10,13-17,20-21,34H,4-5,8-9,11-12,18H2,1-3H3,(H,30,36)(H,31,35) |
| InChIKey | FGUGHQIKHGCOLC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|