About N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide
N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide (PubChem CID 51352909) has the molecular formula C21H19FN4O
and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide |
| PubChem CID | 51352909 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-n2nc(C3CC3)cc2C2CC2)c(F)c1)c1ccncc1 |
| InChI | InChI=1S/C21H19FN4O/c22-17-11-16(24-21(27)15-7-9-23-10-8-15)5-6-19(17)26-20(14-3-4-14)12-18(25-26)13-1-2-13/h5-14H,1-4H2,(H,24,27) |
| InChIKey | CJSSCSFJKBMVPA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide?
The IUPAC name of N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide (CID 51352909) is N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide.
What is the SMILES notation for N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide?
The canonical SMILES for N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide is O=C(Nc1ccc(-n2nc(C3CC3)cc2C2CC2)c(F)c1)c1ccncc1.
What is the InChIKey of N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide?
The InChIKey is CJSSCSFJKBMVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN4O/c22-17-11-16(24-21(27)15-7-9-23-10-8-15)5-6-19(17)26-20(14-3-4-14)12-18(25-26)13-1-2-13/h5-14H,1-4H2,(H,24,27).
What are the key properties of N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide?
N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide has a molecular weight of 362.41 g/mol, XLogP of 4.41, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,5-dicyclopropylpyrazol-1-yl)-3-fluorophenyl]pyridine-4-carboxamide is sourced from PubChem (CID 51352909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).