C13H13NO — CID 123631469
N-hexa-1,3,5-trien-2-ylbenzamide (PubChem CID 123631469) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-2-ylbenzamide.
| Compound Name | N-hexa-1,3,5-trien-2-ylbenzamide |
|---|---|
| PubChem CID | 123631469 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-hexa-1,3,5-trien-2-ylbenzamide |
| SMILES | C=CC=CC(=C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO/c1-3-4-8-11(2)14-13(15)12-9-6-5-7-10-12/h3-10H,1-2H2,(H,14,15) |
| InChIKey | XLDSMBZWTCOTJO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|