About N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide
N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide (PubChem CID 149306381) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide.
Molecular Properties
| Compound Name | N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide |
| PubChem CID | 149306381 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide |
| SMILES | C=N/C(=N\C=C/C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O/c1-3-9-14-12(13-2)15-11(16)10-7-5-4-6-8-10/h3-9H,2H2,1H3,(H,14,15,16)/b9-3- |
| InChIKey | XXTDGWGEDSWLIK-OQFOIZHKSA-N |
| XLogP | 2.01 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide?
The IUPAC name of N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide (CID 149306381) is N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide.
What is the SMILES notation for N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide?
The canonical SMILES for N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide is C=N/C(=N\C=C/C)NC(=O)c1ccccc1.
What is the InChIKey of N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide?
The InChIKey is XXTDGWGEDSWLIK-OQFOIZHKSA-N. The full InChI is InChI=1S/C12H13N3O/c1-3-9-14-12(13-2)15-11(16)10-7-5-4-6-8-10/h3-9H,2H2,1H3,(H,14,15,16)/b9-3-.
What are the key properties of N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide?
N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide has a molecular weight of 215.26 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N-methylidene-N'-[(Z)-prop-1-enyl]carbamimidoyl]benzamide is sourced from PubChem (CID 149306381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).