C14H16N4O — CID 88954649
N-[(3E)-4-(aminomethylideneamino)-3-(ethylideneamino)buta-1,3-dien-2-yl]benzamide (PubChem CID 88954649) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-[(3E)-4-(aminomethylideneamino)-3-(ethylideneamino)buta-1,3-dien-2-yl]benzamide.
| Compound Name | N-[(3E)-4-(aminomethylideneamino)-3-(ethylideneamino)buta-1,3-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 88954649 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-[(3E)-4-(aminomethylideneamino)-3-(ethylideneamino)buta-1,3-dien-2-yl]benzamide |
| SMILES | C=C(NC(=O)c1ccccc1)C(=C\N=C\N)/N=C/C |
| InChI | InChI=1S/C14H16N4O/c1-3-17-13(9-16-10-15)11(2)18-14(19)12-7-5-4-6-8-12/h3-10H,2H2,1H3,(H2,15,16)(H,18,19)/b13-9+,17-3+ |
| InChIKey | BCKGNWGXAMLUND-JHKQAXPOSA-N |
| XLogP | 1.85 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|