C9H12N4O3 — CID 157303801
N-carbamoylbenzamide;urea (PubChem CID 157303801) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is N-carbamoylbenzamide;urea.
| Compound Name | N-carbamoylbenzamide;urea |
|---|---|
| PubChem CID | 157303801 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-carbamoylbenzamide;urea |
| SMILES | NC(=O)NC(=O)c1ccccc1.NC(N)=O |
| InChI | InChI=1S/C8H8N2O2.CH4N2O/c9-8(12)10-7(11)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H3,9,10,11,12);(H4,2,3,4) |
| InChIKey | BCFCHTYEFWVNSQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |