C16H14N4O4 — CID 70008236
N-carbamoyl-2-[2-(carbamoylcarbamoyl)phenyl]benzamide (PubChem CID 70008236) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is N-carbamoyl-2-[2-(carbamoylcarbamoyl)phenyl]benzamide.
| Compound Name | N-carbamoyl-2-[2-(carbamoylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70008236 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-carbamoyl-2-[2-(carbamoylcarbamoyl)phenyl]benzamide |
| SMILES | NC(=O)NC(=O)c1ccccc1-c1ccccc1C(=O)NC(N)=O |
| InChI | InChI=1S/C16H14N4O4/c17-15(23)19-13(21)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(22)20-16(18)24/h1-8H,(H3,17,19,21,23)(H3,18,20,22,24) |
| InChIKey | CZXXTUUOLBOICC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |