2-(2-aminophenyl)benzoyl chloride

C13H10ClNO — CID 54476428

IUPAC2-(2-aminophenyl)benzoyl chloride
SMILESNc1ccccc1-c1ccccc1C(=O)Cl
InChIInChI=1S/C13H10ClNO/c14-13(16)11-7-2-1-5-9(11)10-6-3-4-8-12(10)15/h1-8H,15H2
InChIKeyXLXBUBASCZRKHH-UHFFFAOYSA-N
MW231.68 g/mol
LogP3.31
Rot. Bonds2

About 2-(2-aminophenyl)benzoyl chloride

2-(2-aminophenyl)benzoyl chloride (PubChem CID 54476428) has the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. Its IUPAC name is 2-(2-aminophenyl)benzoyl chloride.

Molecular Properties

Compound Name2-(2-aminophenyl)benzoyl chloride
PubChem CID54476428
Molecular FormulaC13H10ClNO
Molecular Weight231.68 g/mol
Exact Mass231.05
IUPAC Name2-(2-aminophenyl)benzoyl chloride
SMILESNc1ccccc1-c1ccccc1C(=O)Cl
InChIInChI=1S/C13H10ClNO/c14-13(16)11-7-2-1-5-9(11)10-6-3-4-8-12(10)15/h1-8H,15H2
InChIKeyXLXBUBASCZRKHH-UHFFFAOYSA-N
XLogP3.31
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.68
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(2-aminophenyl)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-aminophenyl)benzoyl chloride?
The IUPAC name of 2-(2-aminophenyl)benzoyl chloride (CID 54476428) is 2-(2-aminophenyl)benzoyl chloride.
What is the SMILES notation for 2-(2-aminophenyl)benzoyl chloride?
The canonical SMILES for 2-(2-aminophenyl)benzoyl chloride is Nc1ccccc1-c1ccccc1C(=O)Cl.
What is the InChIKey of 2-(2-aminophenyl)benzoyl chloride?
The InChIKey is XLXBUBASCZRKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO/c14-13(16)11-7-2-1-5-9(11)10-6-3-4-8-12(10)15/h1-8H,15H2.
What are the key properties of 2-(2-aminophenyl)benzoyl chloride?
2-(2-aminophenyl)benzoyl chloride has a molecular weight of 231.68 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)benzoyl chloride is sourced from PubChem (CID 54476428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).