About bis(2-aminobenzamide);platinum(2+)
bis(2-aminobenzamide);platinum(2+) (PubChem CID 50912239) has the molecular formula C14H16N4O2Pt+2
and a molecular weight of 467.39 g/mol. Its IUPAC name is bis(2-aminobenzamide);platinum(2+).
Molecular Properties
| Compound Name | bis(2-aminobenzamide);platinum(2+) |
| PubChem CID | 50912239 |
| Molecular Formula | C14H16N4O2Pt+2 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | bis(2-aminobenzamide);platinum(2+) |
| SMILES | NC(=O)c1ccccc1N.NC(=O)c1ccccc1N.[Pt+2] |
| InChI | InChI=1S/2C7H8N2O.Pt/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4H,8H2,(H2,9,10);/q;;+2 |
| InChIKey | MGODCRYOSKVWAB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminobenzamide);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminobenzamide);platinum(2+)?
The IUPAC name of bis(2-aminobenzamide);platinum(2+) (CID 50912239) is bis(2-aminobenzamide);platinum(2+).
What is the SMILES notation for bis(2-aminobenzamide);platinum(2+)?
The canonical SMILES for bis(2-aminobenzamide);platinum(2+) is NC(=O)c1ccccc1N.NC(=O)c1ccccc1N.[Pt+2].
What is the InChIKey of bis(2-aminobenzamide);platinum(2+)?
The InChIKey is MGODCRYOSKVWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8N2O.Pt/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4H,8H2,(H2,9,10);/q;;+2.
What are the key properties of bis(2-aminobenzamide);platinum(2+)?
bis(2-aminobenzamide);platinum(2+) has a molecular weight of 467.39 g/mol, XLogP of 0.73, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminobenzamide);platinum(2+) is sourced from PubChem (CID 50912239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).