About 2-aminobenzamide;piperidine-1-carboxylic acid
2-aminobenzamide;piperidine-1-carboxylic acid (PubChem CID 174784714) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-aminobenzamide;piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-aminobenzamide;piperidine-1-carboxylic acid |
| PubChem CID | 174784714 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-aminobenzamide;piperidine-1-carboxylic acid |
| SMILES | NC(=O)c1ccccc1N.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C7H8N2O.C6H11NO2/c8-6-4-2-1-3-5(6)7(9)10;8-6(9)7-4-2-1-3-5-7/h1-4H,8H2,(H2,9,10);1-5H2,(H,8,9) |
| InChIKey | JROIGLDITACXIK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;piperidine-1-carboxylic acid?
The IUPAC name of 2-aminobenzamide;piperidine-1-carboxylic acid (CID 174784714) is 2-aminobenzamide;piperidine-1-carboxylic acid.
What is the SMILES notation for 2-aminobenzamide;piperidine-1-carboxylic acid?
The canonical SMILES for 2-aminobenzamide;piperidine-1-carboxylic acid is NC(=O)c1ccccc1N.O=C(O)N1CCCCC1.
What is the InChIKey of 2-aminobenzamide;piperidine-1-carboxylic acid?
The InChIKey is JROIGLDITACXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C6H11NO2/c8-6-4-2-1-3-5(6)7(9)10;8-6(9)7-4-2-1-3-5-7/h1-4H,8H2,(H2,9,10);1-5H2,(H,8,9).
What are the key properties of 2-aminobenzamide;piperidine-1-carboxylic acid?
2-aminobenzamide;piperidine-1-carboxylic acid has a molecular weight of 265.31 g/mol, XLogP of 1.52, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;piperidine-1-carboxylic acid is sourced from PubChem (CID 174784714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).