About 2-aminobenzamide;benzenecarbothioamide
2-aminobenzamide;benzenecarbothioamide (PubChem CID 175524927) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-aminobenzamide;benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-aminobenzamide;benzenecarbothioamide |
| PubChem CID | 175524927 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-aminobenzamide;benzenecarbothioamide |
| SMILES | NC(=O)c1ccccc1N.NC(=S)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O.C7H7NS/c8-6-4-2-1-3-5(6)7(9)10;8-7(9)6-4-2-1-3-5-6/h1-4H,8H2,(H2,9,10);1-5H,(H2,8,9) |
| InChIKey | VXXJMFOIPRWGAF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;benzenecarbothioamide?
The IUPAC name of 2-aminobenzamide;benzenecarbothioamide (CID 175524927) is 2-aminobenzamide;benzenecarbothioamide.
What is the SMILES notation for 2-aminobenzamide;benzenecarbothioamide?
The canonical SMILES for 2-aminobenzamide;benzenecarbothioamide is NC(=O)c1ccccc1N.NC(=S)c1ccccc1.
What is the InChIKey of 2-aminobenzamide;benzenecarbothioamide?
The InChIKey is VXXJMFOIPRWGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C7H7NS/c8-6-4-2-1-3-5(6)7(9)10;8-7(9)6-4-2-1-3-5-6/h1-4H,8H2,(H2,9,10);1-5H,(H2,8,9).
What are the key properties of 2-aminobenzamide;benzenecarbothioamide?
2-aminobenzamide;benzenecarbothioamide has a molecular weight of 273.36 g/mol, XLogP of 1.69, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;benzenecarbothioamide is sourced from PubChem (CID 175524927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).