About (2-aminophenyl)-phenylmethanone;diphenylmethanone
(2-aminophenyl)-phenylmethanone;diphenylmethanone (PubChem CID 90112643) has the molecular formula C26H21NO2
and a molecular weight of 379.46 g/mol. Its IUPAC name is (2-aminophenyl)-phenylmethanone;diphenylmethanone.
Molecular Properties
| Compound Name | (2-aminophenyl)-phenylmethanone;diphenylmethanone |
| PubChem CID | 90112643 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2-aminophenyl)-phenylmethanone;diphenylmethanone |
| SMILES | Nc1ccccc1C(=O)c1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11NO.C13H10O/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-9H,14H2;1-10H |
| InChIKey | MQATUNJJDJDBBU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)-phenylmethanone;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)-phenylmethanone;diphenylmethanone?
The IUPAC name of (2-aminophenyl)-phenylmethanone;diphenylmethanone (CID 90112643) is (2-aminophenyl)-phenylmethanone;diphenylmethanone.
What is the SMILES notation for (2-aminophenyl)-phenylmethanone;diphenylmethanone?
The canonical SMILES for (2-aminophenyl)-phenylmethanone;diphenylmethanone is Nc1ccccc1C(=O)c1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2-aminophenyl)-phenylmethanone;diphenylmethanone?
The InChIKey is MQATUNJJDJDBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.C13H10O/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-9H,14H2;1-10H.
What are the key properties of (2-aminophenyl)-phenylmethanone;diphenylmethanone?
(2-aminophenyl)-phenylmethanone;diphenylmethanone has a molecular weight of 379.46 g/mol, XLogP of 5.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)-phenylmethanone;diphenylmethanone is sourced from PubChem (CID 90112643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).