About 2-aminobenzamide;2-chloropyridine
2-aminobenzamide;2-chloropyridine (PubChem CID 174256918) has the molecular formula C12H12ClN3O
and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-aminobenzamide;2-chloropyridine.
Molecular Properties
| Compound Name | 2-aminobenzamide;2-chloropyridine |
| PubChem CID | 174256918 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-aminobenzamide;2-chloropyridine |
| SMILES | Clc1ccccn1.NC(=O)c1ccccc1N |
| InChI | InChI=1S/C7H8N2O.C5H4ClN/c8-6-4-2-1-3-5(6)7(9)10;6-5-3-1-2-4-7-5/h1-4H,8H2,(H2,9,10);1-4H |
| InChIKey | IAPMLTVDVJADPA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;2-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;2-chloropyridine?
The IUPAC name of 2-aminobenzamide;2-chloropyridine (CID 174256918) is 2-aminobenzamide;2-chloropyridine.
What is the SMILES notation for 2-aminobenzamide;2-chloropyridine?
The canonical SMILES for 2-aminobenzamide;2-chloropyridine is Clc1ccccn1.NC(=O)c1ccccc1N.
What is the InChIKey of 2-aminobenzamide;2-chloropyridine?
The InChIKey is IAPMLTVDVJADPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C5H4ClN/c8-6-4-2-1-3-5(6)7(9)10;6-5-3-1-2-4-7-5/h1-4H,8H2,(H2,9,10);1-4H.
What are the key properties of 2-aminobenzamide;2-chloropyridine?
2-aminobenzamide;2-chloropyridine has a molecular weight of 249.70 g/mol, XLogP of 2.10, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;2-chloropyridine is sourced from PubChem (CID 174256918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).