About 2-chloropyridine;copper;pentane-2,4-dione
2-chloropyridine;copper;pentane-2,4-dione (PubChem CID 174556580) has the molecular formula C10H12ClCuNO2
and a molecular weight of 277.21 g/mol. Its IUPAC name is 2-chloropyridine;copper;pentane-2,4-dione.
Molecular Properties
| Compound Name | 2-chloropyridine;copper;pentane-2,4-dione |
| PubChem CID | 174556580 |
| Molecular Formula | C10H12ClCuNO2 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-chloropyridine;copper;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.Clc1ccccn1.[Cu] |
| InChI | InChI=1S/C5H4ClN.C5H8O2.Cu/c6-5-3-1-2-4-7-5;1-4(6)3-5(2)7;/h1-4H;3H2,1-2H3; |
| InChIKey | RCEKCZORPASHAT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyridine;copper;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridine;copper;pentane-2,4-dione?
The IUPAC name of 2-chloropyridine;copper;pentane-2,4-dione (CID 174556580) is 2-chloropyridine;copper;pentane-2,4-dione.
What is the SMILES notation for 2-chloropyridine;copper;pentane-2,4-dione?
The canonical SMILES for 2-chloropyridine;copper;pentane-2,4-dione is CC(=O)CC(C)=O.Clc1ccccn1.[Cu].
What is the InChIKey of 2-chloropyridine;copper;pentane-2,4-dione?
The InChIKey is RCEKCZORPASHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClN.C5H8O2.Cu/c6-5-3-1-2-4-7-5;1-4(6)3-5(2)7;/h1-4H;3H2,1-2H3;.
What are the key properties of 2-chloropyridine;copper;pentane-2,4-dione?
2-chloropyridine;copper;pentane-2,4-dione has a molecular weight of 277.21 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridine;copper;pentane-2,4-dione is sourced from PubChem (CID 174556580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).