C18H16IrNO2S- — CID 59413495
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-dione (PubChem CID 59413495) has the molecular formula C18H16IrNO2S- and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-dione.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-dione |
|---|---|
| PubChem CID | 59413495 |
| Molecular Formula | C18H16IrNO2S- |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C13H8NS.C5H8O2.Ir/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;1-4(6)3-5(2)7;/h1-8H;3H2,1-2H3;/q-1;; |
| InChIKey | BPKVPFRAUZSGBP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|