C20H18IrNO2- — CID 164702305
iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;pentane-2,4-dione (PubChem CID 164702305) has the molecular formula C20H18IrNO2- and a molecular weight of 496.59 g/mol. Its IUPAC name is iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;pentane-2,4-dione.
| Compound Name | iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;pentane-2,4-dione |
|---|---|
| PubChem CID | 164702305 |
| Molecular Formula | C20H18IrNO2- |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | iridium;2-(2H-naphthalen-2-id-1-yl)pyridine;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.[Ir].[c-]1ccc2ccccc2c1-c1ccccn1 |
| InChI | InChI=1S/C15H10N.C5H8O2.Ir/c1-2-8-13-12(6-1)7-5-9-14(13)15-10-3-4-11-16-15;1-4(6)3-5(2)7;/h1-8,10-11H;3H2,1-2H3;/q-1;; |
| InChIKey | CAUJVYXXYHIDMM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|