C21H26IrNO2- — CID 154600620
iridium;methanol;5-(2-methylpropyl)-2-(2H-naphthalen-2-id-1-yl)pyridine (PubChem CID 154600620) has the molecular formula C21H26IrNO2- and a molecular weight of 516.66 g/mol. Its IUPAC name is iridium;methanol;5-(2-methylpropyl)-2-(2H-naphthalen-2-id-1-yl)pyridine.
| Compound Name | iridium;methanol;5-(2-methylpropyl)-2-(2H-naphthalen-2-id-1-yl)pyridine |
|---|---|
| PubChem CID | 154600620 |
| Molecular Formula | C21H26IrNO2- |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | iridium;methanol;5-(2-methylpropyl)-2-(2H-naphthalen-2-id-1-yl)pyridine |
| SMILES | CC(C)Cc1ccc(-c2[c-]ccc3ccccc23)nc1.CO.CO.[Ir] |
| InChI | InChI=1S/C19H18N.2CH4O.Ir/c1-14(2)12-15-10-11-19(20-13-15)18-9-5-7-16-6-3-4-8-17(16)18;2*1-2;/h3-8,10-11,13-14H,12H2,1-2H3;2*2H,1H3;/q-1;;; |
| InChIKey | TXPWRBNSVMTHGW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|