C29H30IrNO2- — CID 168745310
2-(11,11-dimethyl-9H-benzo[a]fluoren-9-id-10-yl)pyridine;1,1,1,5,5,5-hexadeuteriopentane-2,4-diol;iridium (PubChem CID 168745310) has the molecular formula C29H30IrNO2- and a molecular weight of 622.82 g/mol. Its IUPAC name is 2-(11,11-dimethyl-9H-benzo[a]fluoren-9-id-10-yl)pyridine;1,1,1,5,5,5-hexadeuteriopentane-2,4-diol;iridium.
| Compound Name | 2-(11,11-dimethyl-9H-benzo[a]fluoren-9-id-10-yl)pyridine;1,1,1,5,5,5-hexadeuteriopentane-2,4-diol;iridium |
|---|---|
| PubChem CID | 168745310 |
| Molecular Formula | C29H30IrNO2- |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 2-(11,11-dimethyl-9H-benzo[a]fluoren-9-id-10-yl)pyridine;1,1,1,5,5,5-hexadeuteriopentane-2,4-diol;iridium |
| SMILES | CC1(C)c2c(-c3ccccn3)[c-]ccc2-c2ccc3ccccc3c21.[2H]C([2H])([2H])C(O)CC(O)C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C24H18N.C5H12O2.Ir/c1-24(2)22-17-9-4-3-8-16(17)13-14-19(22)18-10-7-11-20(23(18)24)21-12-5-6-15-25-21;1-4(6)3-5(2)7;/h3-10,12-15H,1-2H3;4-7H,3H2,1-2H3;/q-1;;/i;1D3,2D3; |
| InChIKey | KHFNSTKATIBIGK-RUHQGNAASA-N |
| XLogP | 6.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|