C39H50IrNO2- — CID 168745253
2-(2-tert-butyl-11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;2,2,6,6-tetramethylheptane-3,5-diol (PubChem CID 168745253) has the molecular formula C39H50IrNO2- and a molecular weight of 757.05 g/mol. Its IUPAC name is 2-(2-tert-butyl-11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;2,2,6,6-tetramethylheptane-3,5-diol.
| Compound Name | 2-(2-tert-butyl-11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;2,2,6,6-tetramethylheptane-3,5-diol |
|---|---|
| PubChem CID | 168745253 |
| Molecular Formula | C39H50IrNO2- |
| Molecular Weight | 757.05 g/mol |
| Exact Mass | 757.35 |
| IUPAC Name | 2-(2-tert-butyl-11,11-dimethyl-8H-benzo[a]fluoren-8-id-9-yl)pyridine;iridium;2,2,6,6-tetramethylheptane-3,5-diol |
| SMILES | CC(C)(C)C(O)CC(O)C(C)(C)C.CC(C)(C)c1ccc2ccc3c(c2c1)C(C)(C)c1cc(-c2ccccn2)[c-]cc1-3.[Ir] |
| InChI | InChI=1S/C28H26N.C11H24O2.Ir/c1-27(2,3)20-12-9-18-10-14-22-21-13-11-19(25-8-6-7-15-29-25)16-24(21)28(4,5)26(22)23(18)17-20;1-10(2,3)8(12)7-9(13)11(4,5)6;/h6-10,12-17H,1-5H3;8-9,12-13H,7H2,1-6H3;/q-1;; |
| InChIKey | HOZQURWXEMVTRO-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.05 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|