C28H27N — CID 168812331
2-(3-tert-butyl-11,11-dimethylbenzo[a]fluoren-8-yl)pyridine (PubChem CID 168812331) has the molecular formula C28H27N and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-(3-tert-butyl-11,11-dimethylbenzo[a]fluoren-8-yl)pyridine.
| Compound Name | 2-(3-tert-butyl-11,11-dimethylbenzo[a]fluoren-8-yl)pyridine |
|---|---|
| PubChem CID | 168812331 |
| Molecular Formula | C28H27N |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(3-tert-butyl-11,11-dimethylbenzo[a]fluoren-8-yl)pyridine |
| SMILES | CC(C)(C)c1ccc2c3c(ccc2c1)-c1cc(-c2ccccn2)ccc1C3(C)C |
| InChI | InChI=1S/C28H27N/c1-27(2,3)20-11-13-21-18(16-20)9-12-22-23-17-19(25-8-6-7-15-29-25)10-14-24(23)28(4,5)26(21)22/h6-17H,1-5H3 |
| InChIKey | PUQMXQQUHABYME-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |