C42H47N2O2Pt- — CID 59449583
2-(4-tert-butylbenzene-6-id-1-yl)pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum (PubChem CID 59449583) has the molecular formula C42H47N2O2Pt- and a molecular weight of 806.93 g/mol. Its IUPAC name is 2-(4-tert-butylbenzene-6-id-1-yl)pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum.
| Compound Name | 2-(4-tert-butylbenzene-6-id-1-yl)pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum |
|---|---|
| PubChem CID | 59449583 |
| Molecular Formula | C42H47N2O2Pt- |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 806.33 |
| IUPAC Name | 2-(4-tert-butylbenzene-6-id-1-yl)pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum |
| SMILES | CC(C)(C)C(O)CC(O)CCc1ccc(-n2c3ccccc3c3ccccc32)cc1.CC(C)(C)c1c[c-]c(-c2ccccn2)cc1.[Pt] |
| InChI | InChI=1S/C27H31NO2.C15H16N.Pt/c1-27(2,3)26(30)18-21(29)17-14-19-12-15-20(16-13-19)28-24-10-6-4-8-22(24)23-9-5-7-11-25(23)28;1-15(2,3)13-9-7-12(8-10-13)14-6-4-5-11-16-14;/h4-13,15-16,21,26,29-30H,14,17-18H2,1-3H3;4-7,9-11H,1-3H3;/q;-1; |
| InChIKey | LTWUKDUMLFQCDP-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|