C75H58IrN3- — CID 159788517
2-(4-butylbenzene-6-id-1-yl)pyridine;4-(3-carbazol-9-ylphenyl)-N,N-bis[4-(3-phenylphenyl)phenyl]aniline;iridium (PubChem CID 159788517) has the molecular formula C75H58IrN3- and a molecular weight of 1193.53 g/mol. Its IUPAC name is 2-(4-butylbenzene-6-id-1-yl)pyridine;4-(3-carbazol-9-ylphenyl)-N,N-bis[4-(3-phenylphenyl)phenyl]aniline;iridium.
| Compound Name | 2-(4-butylbenzene-6-id-1-yl)pyridine;4-(3-carbazol-9-ylphenyl)-N,N-bis[4-(3-phenylphenyl)phenyl]aniline;iridium |
|---|---|
| PubChem CID | 159788517 |
| Molecular Formula | C75H58IrN3- |
| Molecular Weight | 1193.53 g/mol |
| Exact Mass | 1193.43 |
| IUPAC Name | 2-(4-butylbenzene-6-id-1-yl)pyridine;4-(3-carbazol-9-ylphenyl)-N,N-bis[4-(3-phenylphenyl)phenyl]aniline;iridium |
| SMILES | CCCCc1c[c-]c(-c2ccccn2)cc1.[Ir].c1ccc(-c2cccc(-c3ccc(N(c4ccc(-c5cccc(-c6ccccc6)c5)cc4)c4ccc(-c5cccc(-n6c7ccccc7c7ccccc76)c5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C60H42N2.C15H16N.Ir/c1-3-14-43(15-4-1)48-18-11-20-50(40-48)45-28-34-53(35-29-45)61(54-36-30-46(31-37-54)51-21-12-19-49(41-51)44-16-5-2-6-17-44)55-38-32-47(33-39-55)52-22-13-23-56(42-52)62-59-26-9-7-24-57(59)58-25-8-10-27-60(58)62;1-2-3-6-13-8-10-14(11-9-13)15-7-4-5-12-16-15;/h1-42H;4-5,7-10,12H,2-3,6H2,1H3;/q;-1; |
| InChIKey | PWEWMWQWUVVCPN-UHFFFAOYSA-N |
| XLogP | 20.48 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1193.53 |
| LogP ≤ 5 | 20.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|