C52H37IrN2- — CID 58793277
iridium;9-[4-[7'-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]phenyl]carbazole (PubChem CID 58793277) has the molecular formula C52H37IrN2- and a molecular weight of 882.10 g/mol. Its IUPAC name is iridium;9-[4-[7'-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]phenyl]carbazole.
| Compound Name | iridium;9-[4-[7'-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 58793277 |
| Molecular Formula | C52H37IrN2- |
| Molecular Weight | 882.10 g/mol |
| Exact Mass | 882.26 |
| IUPAC Name | iridium;9-[4-[7'-[4-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]phenyl]carbazole |
| SMILES | [Ir].[c-]1cc(-c2ccc(-c3ccc4c(c3)C3(CCCC3)c3cc(-c5ccc(-n6c7ccccc7c7ccccc76)cc5)ccc3-4)cc2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C52H37N2.Ir/c1-3-12-50-45(9-1)46-10-2-4-13-51(46)54(50)42-26-22-38(23-27-42)41-25-29-44-43-28-24-40(33-47(43)52(48(44)34-41)30-6-7-31-52)37-16-14-35(15-17-37)36-18-20-39(21-19-36)49-11-5-8-32-53-49;/h1-5,8-20,22-29,32-34H,6-7,30-31H2;/q-1; |
| InChIKey | NWUBKHMDNVOWBD-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.10 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|