C69H51IrN2- — CID 58793207
iridium;9-[4-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]-3,6-di(spiro[cyclopentane-1,9'-fluorene]-2'-yl)carbazole (PubChem CID 58793207) has the molecular formula C69H51IrN2- and a molecular weight of 1100.40 g/mol. Its IUPAC name is iridium;9-[4-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]-3,6-di(spiro[cyclopentane-1,9'-fluorene]-2'-yl)carbazole.
| Compound Name | iridium;9-[4-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]-3,6-di(spiro[cyclopentane-1,9'-fluorene]-2'-yl)carbazole |
|---|---|
| PubChem CID | 58793207 |
| Molecular Formula | C69H51IrN2- |
| Molecular Weight | 1100.40 g/mol |
| Exact Mass | 1100.37 |
| IUPAC Name | iridium;9-[4-[3-(3-pyridin-2-ylbenzene-4-id-1-yl)phenyl]phenyl]-3,6-di(spiro[cyclopentane-1,9'-fluorene]-2'-yl)carbazole |
| SMILES | [Ir].[c-]1ccc(-c2cccc(-c3ccc(-n4c5ccc(-c6ccc7c(c6)C6(CCCC6)c6ccccc6-7)cc5c5cc(-c6ccc7c(c6)C6(CCCC6)c6ccccc6-7)ccc54)cc3)c2)cc1-c1ccccn1 |
| InChI | InChI=1S/C69H51N2.Ir/c1-3-19-61-55(17-1)57-30-24-51(43-63(57)68(61)34-6-7-35-68)49-26-32-66-59(41-49)60-42-50(52-25-31-58-56-18-2-4-20-62(56)69(64(58)44-52)36-8-9-37-69)27-33-67(60)71(66)54-28-22-45(23-29-54)46-13-11-14-47(39-46)48-15-12-16-53(40-48)65-21-5-10-38-70-65;/h1-5,10-15,17-33,38-44H,6-9,34-37H2;/q-1; |
| InChIKey | WOVHKGDVEUMHJG-UHFFFAOYSA-N |
| XLogP | 17.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1100.40 |
| LogP ≤ 5 | 17.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|