C69H59AuN6 — CID 171748805
2,4-bis(4-tert-butylbenzene-6-id-1-yl)-6-(4-tert-butylphenyl)-1,3,5-triazine;3,6-di(carbazol-9-yl)carbazol-9-ide;gold(3+) (PubChem CID 171748805) has the molecular formula C69H59AuN6 and a molecular weight of 1169.24 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylbenzene-6-id-1-yl)-6-(4-tert-butylphenyl)-1,3,5-triazine;3,6-di(carbazol-9-yl)carbazol-9-ide;gold(3+).
| Compound Name | 2,4-bis(4-tert-butylbenzene-6-id-1-yl)-6-(4-tert-butylphenyl)-1,3,5-triazine;3,6-di(carbazol-9-yl)carbazol-9-ide;gold(3+) |
|---|---|
| PubChem CID | 171748805 |
| Molecular Formula | C69H59AuN6 |
| Molecular Weight | 1169.24 g/mol |
| Exact Mass | 1168.45 |
| IUPAC Name | 2,4-bis(4-tert-butylbenzene-6-id-1-yl)-6-(4-tert-butylphenyl)-1,3,5-triazine;3,6-di(carbazol-9-yl)carbazol-9-ide;gold(3+) |
| SMILES | CC(C)(C)c1c[c-]c(-c2nc(-c3[c-]cc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1.[Au+3].c1ccc2c(c1)c1ccccc1n2-c1ccc2[n-]c3ccc(-n4c5ccccc5c5ccccc54)cc3c2c1 |
| InChI | InChI=1S/C36H22N3.C33H37N3.Au/c1-5-13-33-25(9-1)26-10-2-6-14-34(26)38(33)23-17-19-31-29(21-23)30-22-24(18-20-32(30)37-31)39-35-15-7-3-11-27(35)28-12-4-8-16-36(28)39;1-31(2,3)25-16-10-22(11-17-25)28-34-29(23-12-18-26(19-13-23)32(4,5)6)36-30(35-28)24-14-20-27(21-15-24)33(7,8)9;/h1-22H;10-12,14,16-21H,1-9H3;/q-1;-2;+3 |
| InChIKey | LZXRWYIMRZINJV-UHFFFAOYSA-N |
| XLogP | 17.51 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.24 |
| LogP ≤ 5 | 17.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|