C17H12Cl2N2 — CID 129129461
13,15-dichloro-17,17-dimethyl-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 129129461) has the molecular formula C17H12Cl2N2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 13,15-dichloro-17,17-dimethyl-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 13,15-dichloro-17,17-dimethyl-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 129129461 |
| Molecular Formula | C17H12Cl2N2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 13,15-dichloro-17,17-dimethyl-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | CC1(C)c2c(Cl)nc(Cl)nc2-c2ccc3ccccc3c21 |
| InChI | InChI=1S/C17H12Cl2N2/c1-17(2)12-10-6-4-3-5-9(10)7-8-11(12)14-13(17)15(18)21-16(19)20-14/h3-8H,1-2H3 |
| InChIKey | OOUOORZSNLQZDR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |