About 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium (PubChem CID 158906670) has the molecular formula C26H17IrN2S2-
and a molecular weight of 613.79 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium.
Molecular Properties
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium |
| PubChem CID | 158906670 |
| Molecular Formula | C26H17IrN2S2- |
| Molecular Weight | 613.79 g/mol |
| Exact Mass | 614.05 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium |
| SMILES | [Ir].[c-]1c(-c2ccccn2)sc2ccccc12.c1ccc(-c2cc3ccccc3s2)nc1 |
| InChI | InChI=1S/C13H9NS.C13H8NS.Ir/c2*1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h1-9H;1-8H;/q;-1; |
| InChIKey | MAKXRHLTHBMVDU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 613.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium?
The IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium (CID 158906670) is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium.
What is the SMILES notation for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium?
The canonical SMILES for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium is [Ir].[c-]1c(-c2ccccn2)sc2ccccc12.c1ccc(-c2cc3ccccc3s2)nc1.
What is the InChIKey of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium?
The InChIKey is MAKXRHLTHBMVDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS.C13H8NS.Ir/c2*1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h1-9H;1-8H;/q;-1;.
What are the key properties of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium?
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium has a molecular weight of 613.79 g/mol, XLogP of 7.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;2-(1-benzothiophen-2-yl)pyridine;iridium is sourced from PubChem (CID 158906670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).