C14H12F3N3O2 — CID 175305816
benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine (PubChem CID 175305816) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine.
| Compound Name | benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 175305816 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccccn1.NC(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C8H8N2O2.C6H4F3N/c9-7(11)5-3-1-2-4-6(5)8(10)12;7-6(8,9)5-3-1-2-4-10-5/h1-4H,(H2,9,11)(H2,10,12);1-4H |
| InChIKey | GPIFHQKVYUIBIM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |