About benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine
benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine (PubChem CID 175305816) has the molecular formula C14H12F3N3O2
and a molecular weight of 311.26 g/mol. Its IUPAC name is benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine |
| PubChem CID | 175305816 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccccn1.NC(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C8H8N2O2.C6H4F3N/c9-7(11)5-3-1-2-4-6(5)8(10)12;7-6(8,9)5-3-1-2-4-10-5/h1-4H,(H2,9,11)(H2,10,12);1-4H |
| InChIKey | GPIFHQKVYUIBIM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine?
The IUPAC name of benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine (CID 175305816) is benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine.
What is the SMILES notation for benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine?
The canonical SMILES for benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine is FC(F)(F)c1ccccn1.NC(=O)c1ccccc1C(N)=O.
What is the InChIKey of benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine?
The InChIKey is GPIFHQKVYUIBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.C6H4F3N/c9-7(11)5-3-1-2-4-6(5)8(10)12;7-6(8,9)5-3-1-2-4-10-5/h1-4H,(H2,9,11)(H2,10,12);1-4H.
What are the key properties of benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine?
benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine has a molecular weight of 311.26 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarboxamide;2-(trifluoromethyl)pyridine is sourced from PubChem (CID 175305816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).