C21H17N3O4 — CID 59879871
2-[2-[[4-(N'-hydroxycarbamimidoyl)phenyl]carbamoyl]phenyl]benzoic acid (PubChem CID 59879871) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[2-[[4-(N'-hydroxycarbamimidoyl)phenyl]carbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[[4-(N'-hydroxycarbamimidoyl)phenyl]carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 59879871 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[2-[[4-(N'-hydroxycarbamimidoyl)phenyl]carbamoyl]phenyl]benzoic acid |
| SMILES | NC(=NO)c1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H17N3O4/c22-19(24-28)13-9-11-14(12-10-13)23-20(25)17-7-3-1-5-15(17)16-6-2-4-8-18(16)21(26)27/h1-12,28H,(H2,22,24)(H,23,25)(H,26,27) |
| InChIKey | GPYVMYMXKLGHPT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|