C23H20N4O4 — CID 22626009
5-acetamido-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid (PubChem CID 22626009) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 5-acetamido-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid.
| Compound Name | 5-acetamido-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 22626009 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 5-acetamido-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccc(NC(C)=O)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-13(28)26-16-10-11-18(20(12-16)23(30)31)17-4-2-3-5-19(17)22(29)27-15-8-6-14(7-9-15)21(24)25/h2-12H,1H3,(H3,24,25)(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | UHQJRDDXSNHCJF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|